C18H25FO2 — CID 89277441
[(Z,3S)-6-methylidenenon-4-en-3-yl] 3-fluoro-4-methylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 89277441) has the molecular formula C18H25FO2 and a molecular weight of 292.39 g/mol. Its IUPAC name is [(Z,3S)-6-methylidenenon-4-en-3-yl] 3-fluoro-4-methylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | [(Z,3S)-6-methylidenenon-4-en-3-yl] 3-fluoro-4-methylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 89277441 |
| Molecular Formula | C18H25FO2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [(Z,3S)-6-methylidenenon-4-en-3-yl] 3-fluoro-4-methylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | C=C(/C=C\[C@H](CC)OC(=O)C1C=C(F)C(C)=CC1)CCC |
| InChI | InChI=1S/C18H25FO2/c1-5-7-13(3)8-11-16(6-2)21-18(20)15-10-9-14(4)17(19)12-15/h8-9,11-12,15-16H,3,5-7,10H2,1-2,4H3/b11-8-/t15?,16-/m0/s1 |
| InChIKey | BEURHLBMNOJIHK-STQCWQIDSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|