C24H18BrN5O4 — CID 89277528
5-bromo-3-[4-[(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl]-5-(4-nitrophenyl)-1H-imidazol-2-yl]-1H-indole (PubChem CID 89277528) has the molecular formula C24H18BrN5O4 and a molecular weight of 520.34 g/mol. Its IUPAC name is 5-bromo-3-[4-[(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl]-5-(4-nitrophenyl)-1H-imidazol-2-yl]-1H-indole.
| Compound Name | 5-bromo-3-[4-[(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl]-5-(4-nitrophenyl)-1H-imidazol-2-yl]-1H-indole |
|---|---|
| PubChem CID | 89277528 |
| Molecular Formula | C24H18BrN5O4 |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 5-bromo-3-[4-[(2E,4E)-5-nitrohepta-2,4,6-trien-2-yl]-5-(4-nitrophenyl)-1H-imidazol-2-yl]-1H-indole |
| SMILES | C=C/C(=C\C=C(/C)c1nc(-c2c[nH]c3ccc(Br)cc23)[nH]c1-c1ccc([N+](=O)[O-])cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C24H18BrN5O4/c1-3-17(29(31)32)8-4-14(2)22-23(15-5-9-18(10-6-15)30(33)34)28-24(27-22)20-13-26-21-11-7-16(25)12-19(20)21/h3-13,26H,1H2,2H3,(H,27,28)/b14-4+,17-8+ |
| InChIKey | PKXBVZJUZVXKGZ-APEGJYRSSA-N |
| XLogP | 6.65 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|