About 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid
3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 89277585) has the molecular formula C7H7F3O3S
and a molecular weight of 228.19 g/mol. Its IUPAC name is 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid |
| PubChem CID | 89277585 |
| Molecular Formula | C7H7F3O3S |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1=CC(C(F)(F)F)=CCC1 |
| InChI | InChI=1S/C7H7F3O3S/c8-7(9,10)5-2-1-3-6(4-5)14(11,12)13/h2,4H,1,3H2,(H,11,12,13) |
| InChIKey | FEMHKWHWDDHSIN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid?
The IUPAC name of 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid (CID 89277585) is 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid.
What is the SMILES notation for 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid?
The canonical SMILES for 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid is O=S(=O)(O)C1=CC(C(F)(F)F)=CCC1.
What is the InChIKey of 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid?
The InChIKey is FEMHKWHWDDHSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3O3S/c8-7(9,10)5-2-1-3-6(4-5)14(11,12)13/h2,4H,1,3H2,(H,11,12,13).
What are the key properties of 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid?
3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid has a molecular weight of 228.19 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonic acid is sourced from PubChem (CID 89277585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).