C8H8F6O3S — CID 89277718
(3E,5E)-7,7,7-trifluoro-5-(trifluoromethyl)hepta-3,5-diene-3-sulfonic acid (PubChem CID 89277718) has the molecular formula C8H8F6O3S and a molecular weight of 298.20 g/mol. Its IUPAC name is (3E,5E)-7,7,7-trifluoro-5-(trifluoromethyl)hepta-3,5-diene-3-sulfonic acid.
| Compound Name | (3E,5E)-7,7,7-trifluoro-5-(trifluoromethyl)hepta-3,5-diene-3-sulfonic acid |
|---|---|
| PubChem CID | 89277718 |
| Molecular Formula | C8H8F6O3S |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | (3E,5E)-7,7,7-trifluoro-5-(trifluoromethyl)hepta-3,5-diene-3-sulfonic acid |
| SMILES | CC/C(=C\C(=C/C(F)(F)F)C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C8H8F6O3S/c1-2-6(18(15,16)17)3-5(8(12,13)14)4-7(9,10)11/h3-4H,2H2,1H3,(H,15,16,17)/b5-4+,6-3+ |
| InChIKey | MSOGHWRHDGPUQQ-UTTVJGTNSA-N |
| XLogP | 3.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|