About 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one
5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one (PubChem CID 89277830) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one.
Molecular Properties
| Compound Name | 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one |
| PubChem CID | 89277830 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one |
| SMILES | C=C1OCC2C1CC1C(=C)OC(=O)C12 |
| InChI | InChI=1S/C11H12O3/c1-5-7-3-8-6(2)14-11(12)10(8)9(7)4-13-5/h7-10H,1-4H2 |
| InChIKey | VRHOBYXKRNZELD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one?
The IUPAC name of 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one (CID 89277830) is 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one.
What is the SMILES notation for 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one?
The canonical SMILES for 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one is C=C1OCC2C1CC1C(=C)OC(=O)C12.
What is the InChIKey of 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one?
The InChIKey is VRHOBYXKRNZELD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-5-7-3-8-6(2)14-11(12)10(8)9(7)4-13-5/h7-10H,1-4H2.
What are the key properties of 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one?
5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one has a molecular weight of 192.21 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-dimethylidene-4,10-dioxatricyclo[6.3.0.02,6]undecan-3-one is sourced from PubChem (CID 89277830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).