C32H30FNO3S2 — CID 89278009
(4R,5R)-5-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-[2-hydroxy-4-(hydroxymethyl)phenyl]-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione (PubChem CID 89278009) has the molecular formula C32H30FNO3S2 and a molecular weight of 559.73 g/mol. Its IUPAC name is (4R,5R)-5-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-[2-hydroxy-4-(hydroxymethyl)phenyl]-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione.
| Compound Name | (4R,5R)-5-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-[2-hydroxy-4-(hydroxymethyl)phenyl]-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 89278009 |
| Molecular Formula | C32H30FNO3S2 |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (4R,5R)-5-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-[2-hydroxy-4-(hydroxymethyl)phenyl]-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione |
| SMILES | OCc1ccc([C@@H]2[C@@H](CCCC(O)c3ccc(F)cc3)SC(=S)N2c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C32H30FNO3S2/c33-25-14-10-24(11-15-25)28(36)7-4-8-30-31(27-18-9-21(20-35)19-29(27)37)34(32(38)39-30)26-16-12-23(13-17-26)22-5-2-1-3-6-22/h1-3,5-6,9-19,28,30-31,35-37H,4,7-8,20H2/t28?,30-,31-/m1/s1 |
| InChIKey | FOHLAXNTZHRHCS-ZSUYXASHSA-N |
| XLogP | 7.54 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|