About (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene
(Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene (PubChem CID 89278148) has the molecular formula C14H28S
and a molecular weight of 228.44 g/mol. Its IUPAC name is (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene.
Molecular Properties
| Compound Name | (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene |
| PubChem CID | 89278148 |
| Molecular Formula | C14H28S |
| Molecular Weight | 228.44 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene |
| SMILES | CC/C=C\[C@](C)(CC)CC(C)(C)SCC |
| InChI | InChI=1S/C14H28S/c1-7-10-11-14(6,8-2)12-13(4,5)15-9-3/h10-11H,7-9,12H2,1-6H3/b11-10-/t14-/m0/s1 |
| InChIKey | LIQNXUOEHLVNMX-BMSUMIBZSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene?
The IUPAC name of (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene (CID 89278148) is (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene.
What is the SMILES notation for (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene?
The canonical SMILES for (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene is CC/C=C\[C@](C)(CC)CC(C)(C)SCC.
What is the InChIKey of (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene?
The InChIKey is LIQNXUOEHLVNMX-BMSUMIBZSA-N. The full InChI is InChI=1S/C14H28S/c1-7-10-11-14(6,8-2)12-13(4,5)15-9-3/h10-11H,7-9,12H2,1-6H3/b11-10-/t14-/m0/s1.
What are the key properties of (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene?
(Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene has a molecular weight of 228.44 g/mol, XLogP of 5.29, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,5R)-5-ethyl-7-ethylsulfanyl-5,7-dimethyloct-3-ene is sourced from PubChem (CID 89278148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).