C31H28FNO3S2 — CID 89278187
(4R,5R)-4-(2,4-dihydroxyphenyl)-5-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione (PubChem CID 89278187) has the molecular formula C31H28FNO3S2 and a molecular weight of 545.70 g/mol. Its IUPAC name is (4R,5R)-4-(2,4-dihydroxyphenyl)-5-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione.
| Compound Name | (4R,5R)-4-(2,4-dihydroxyphenyl)-5-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 89278187 |
| Molecular Formula | C31H28FNO3S2 |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | (4R,5R)-4-(2,4-dihydroxyphenyl)-5-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione |
| SMILES | Oc1ccc([C@@H]2[C@@H](CCC[C@@H](O)c3ccc(F)cc3)SC(=S)N2c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C31H28FNO3S2/c32-23-13-9-22(10-14-23)27(35)7-4-8-29-30(26-18-17-25(34)19-28(26)36)33(31(37)38-29)24-15-11-21(12-16-24)20-5-2-1-3-6-20/h1-3,5-6,9-19,27,29-30,34-36H,4,7-8H2/t27-,29-,30-/m1/s1 |
| InChIKey | XZECEJFYCIONFN-MJLPRTPSSA-N |
| XLogP | 7.76 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|