C20H16F2N2OS — CID 89278362
4-[1-(2,6-difluorophenyl)ethenylamino]-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-11-ol (PubChem CID 89278362) has the molecular formula C20H16F2N2OS and a molecular weight of 370.42 g/mol. Its IUPAC name is 4-[1-(2,6-difluorophenyl)ethenylamino]-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-11-ol.
| Compound Name | 4-[1-(2,6-difluorophenyl)ethenylamino]-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-11-ol |
|---|---|
| PubChem CID | 89278362 |
| Molecular Formula | C20H16F2N2OS |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-[1-(2,6-difluorophenyl)ethenylamino]-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-11-ol |
| SMILES | C=C(Nc1nc2c(s1)-c1cccc(O)c1CCC2)c1c(F)cccc1F |
| InChI | InChI=1S/C20H16F2N2OS/c1-11(18-14(21)7-4-8-15(18)22)23-20-24-16-9-2-5-12-13(19(16)26-20)6-3-10-17(12)25/h3-4,6-8,10,25H,1-2,5,9H2,(H,23,24) |
| InChIKey | JCPHKUUAQORIPH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |