C11H15N — CID 89278502
N-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]prop-2-en-1-imine (PubChem CID 89278502) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is N-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]prop-2-en-1-imine.
| Compound Name | N-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 89278502 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N-[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C(=C/C=C\C)C(=C)C |
| InChI | InChI=1S/C11H15N/c1-5-7-8-11(10(3)4)12-9-6-2/h5-9H,2-3H2,1,4H3/b7-5-,11-8+,12-9+ |
| InChIKey | OLDUMUGLGRIAAW-YJLVPSINSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|