C9H16N2O2 — CID 89278598
methyl 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate (PubChem CID 89278598) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is methyl 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate.
| Compound Name | methyl 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 89278598 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | methyl 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate |
| SMILES | COC(=O)N1CCCC2CNCC21 |
| InChI | InChI=1S/C9H16N2O2/c1-13-9(12)11-4-2-3-7-5-10-6-8(7)11/h7-8,10H,2-6H2,1H3 |
| InChIKey | UMKBNKJDXWJDLY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |