C21H29ClN4O3 — CID 89278638
9-[1-(5-amino-2-chloropyridine-4-carbonyl)piperidin-4-yl]-3,3-dimethyl-2-oxa-9-azaspiro[4.5]decan-1-one (PubChem CID 89278638) has the molecular formula C21H29ClN4O3 and a molecular weight of 420.94 g/mol. Its IUPAC name is 9-[1-(5-amino-2-chloropyridine-4-carbonyl)piperidin-4-yl]-3,3-dimethyl-2-oxa-9-azaspiro[4.5]decan-1-one.
| Compound Name | 9-[1-(5-amino-2-chloropyridine-4-carbonyl)piperidin-4-yl]-3,3-dimethyl-2-oxa-9-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 89278638 |
| Molecular Formula | C21H29ClN4O3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 9-[1-(5-amino-2-chloropyridine-4-carbonyl)piperidin-4-yl]-3,3-dimethyl-2-oxa-9-azaspiro[4.5]decan-1-one |
| SMILES | CC1(C)CC2(CCCN(C3CCN(C(=O)c4cc(Cl)ncc4N)CC3)C2)C(=O)O1 |
| InChI | InChI=1S/C21H29ClN4O3/c1-20(2)12-21(19(28)29-20)6-3-7-26(13-21)14-4-8-25(9-5-14)18(27)15-10-17(22)24-11-16(15)23/h10-11,14H,3-9,12-13,23H2,1-2H3 |
| InChIKey | YRBNGXZOINLWIW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|