About 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide
5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide (PubChem CID 89278732) has the molecular formula C12H6ClF2I2N3O
and a molecular weight of 535.46 g/mol. Its IUPAC name is 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide |
| PubChem CID | 89278732 |
| Molecular Formula | C12H6ClF2I2N3O |
| Molecular Weight | 535.46 g/mol |
| Exact Mass | 534.83 |
| IUPAC Name | 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide |
| SMILES | NC(=O)c1cc(Cl)c(F)c(F)c1Nc1ncc(I)cc1I |
| InChI | InChI=1S/C12H6ClF2I2N3O/c13-6-2-5(11(18)21)10(9(15)8(6)14)20-12-7(17)1-4(16)3-19-12/h1-3H,(H2,18,21)(H,19,20) |
| InChIKey | JACWEGQAZVEGKG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide?
The IUPAC name of 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide (CID 89278732) is 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide.
What is the SMILES notation for 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide?
The canonical SMILES for 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide is NC(=O)c1cc(Cl)c(F)c(F)c1Nc1ncc(I)cc1I.
What is the InChIKey of 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide?
The InChIKey is JACWEGQAZVEGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6ClF2I2N3O/c13-6-2-5(11(18)21)10(9(15)8(6)14)20-12-7(17)1-4(16)3-19-12/h1-3H,(H2,18,21)(H,19,20).
What are the key properties of 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide?
5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide has a molecular weight of 535.46 g/mol, XLogP of 4.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(3,5-diiodo-2-pyridinyl)amino]-3,4-difluorobenzamide is sourced from PubChem (CID 89278732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).