C12H13Cl2F2NO5S — CID 89279159
2,2-dichloro-N-[(1R,2S)-3-fluoro-1-[4-(fluoromethylsulfonyl)phenyl]-1-hydroperoxypropan-2-yl]acetamide (PubChem CID 89279159) has the molecular formula C12H13Cl2F2NO5S and a molecular weight of 392.21 g/mol. Its IUPAC name is 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-[4-(fluoromethylsulfonyl)phenyl]-1-hydroperoxypropan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-[4-(fluoromethylsulfonyl)phenyl]-1-hydroperoxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 89279159 |
| Molecular Formula | C12H13Cl2F2NO5S |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-[4-(fluoromethylsulfonyl)phenyl]-1-hydroperoxypropan-2-yl]acetamide |
| SMILES | O=C(N[C@H](CF)[C@H](OO)c1ccc(S(=O)(=O)CF)cc1)C(Cl)Cl |
| InChI | InChI=1S/C12H13Cl2F2NO5S/c13-11(14)12(18)17-9(5-15)10(22-19)7-1-3-8(4-2-7)23(20,21)6-16/h1-4,9-11,19H,5-6H2,(H,17,18)/t9-,10-/m1/s1 |
| InChIKey | ZVDYSKUCAHXGKQ-NXEZZACHSA-N |
| XLogP | 2.18 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|