C41H38N4O2 — CID 89279316
2-[2-[(E)-2-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-[(E)-2-(9-methylcarbazol-3-yl)ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 89279316) has the molecular formula C41H38N4O2 and a molecular weight of 618.78 g/mol. Its IUPAC name is 2-[2-[(E)-2-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-[(E)-2-(9-methylcarbazol-3-yl)ethenyl]pyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[(E)-2-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-[(E)-2-(9-methylcarbazol-3-yl)ethenyl]pyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 89279316 |
| Molecular Formula | C41H38N4O2 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 2-[2-[(E)-2-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-[(E)-2-(9-methylcarbazol-3-yl)ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | Cn1c2ccccc2c2cc(/C=C/C3=CC(=C(C#N)C#N)C=C(/C=C/c4cc5c6c(c4O)C(C)(C)CCN6CCC5(C)C)O3)ccc21 |
| InChI | InChI=1S/C41H38N4O2/c1-40(2)16-18-45-19-17-41(3,4)37-38(45)34(40)23-27(39(37)46)12-14-31-22-28(29(24-42)25-43)21-30(47-31)13-10-26-11-15-36-33(20-26)32-8-6-7-9-35(32)44(36)5/h6-15,20-23,46H,16-19H2,1-5H3/b13-10+,14-12+ |
| InChIKey | VOCDVBIYKVXKJY-ADWQEOMMSA-N |
| XLogP | 9.07 |
| TPSA | 85.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|