C19H20N6O6S — CID 89279460
N-[(7R)-7-hydroxy-2-methyl-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(4-hydroxyphenyl)-3-oxopropanamide (PubChem CID 89279460) has the molecular formula C19H20N6O6S and a molecular weight of 460.47 g/mol. Its IUPAC name is N-[(7R)-7-hydroxy-2-methyl-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(4-hydroxyphenyl)-3-oxopropanamide.
| Compound Name | N-[(7R)-7-hydroxy-2-methyl-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(4-hydroxyphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 89279460 |
| Molecular Formula | C19H20N6O6S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[(7R)-7-hydroxy-2-methyl-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(4-hydroxyphenyl)-3-oxopropanamide |
| SMILES | CC1=C(CSc2nnnn2C)COC2N1C(=O)[C@@]2(O)NC(=O)C(C=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H20N6O6S/c1-10-12(9-32-18-21-22-23-24(18)2)8-31-17-19(30,16(29)25(10)17)20-15(28)14(7-26)11-3-5-13(27)6-4-11/h3-7,14,17,27,30H,8-9H2,1-2H3,(H,20,28)/t14?,17?,19-/m0/s1 |
| InChIKey | CMKYLOJYTWEFGN-YVNUBYTISA-N |
| XLogP | -0.73 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|