C63H38N10 — CID 89279930
2-[3,5-bis(6-phenyl-2-quinolin-3-ylpyrimidin-4-yl)phenyl]-3-phenylimidazo[4,5-f][1,10]phenanthroline (PubChem CID 89279930) has the molecular formula C63H38N10 and a molecular weight of 935.07 g/mol. Its IUPAC name is 2-[3,5-bis(6-phenyl-2-quinolin-3-ylpyrimidin-4-yl)phenyl]-3-phenylimidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 2-[3,5-bis(6-phenyl-2-quinolin-3-ylpyrimidin-4-yl)phenyl]-3-phenylimidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 89279930 |
| Molecular Formula | C63H38N10 |
| Molecular Weight | 935.07 g/mol |
| Exact Mass | 934.33 |
| IUPAC Name | 2-[3,5-bis(6-phenyl-2-quinolin-3-ylpyrimidin-4-yl)phenyl]-3-phenylimidazo[4,5-f][1,10]phenanthroline |
| SMILES | c1ccc(-c2cc(-c3cc(-c4cc(-c5ccccc5)nc(-c5cnc6ccccc6c5)n4)cc(-c4nc5c6cccnc6c6ncccc6c5n4-c4ccccc4)c3)nc(-c3cnc4ccccc4c3)n2)cc1 |
| InChI | InChI=1S/C63H38N10/c1-4-16-39(17-5-1)53-35-55(70-61(68-53)46-30-41-20-10-12-26-51(41)66-37-46)43-32-44(56-36-54(40-18-6-2-7-19-40)69-62(71-56)47-31-42-21-11-13-27-52(42)67-38-47)34-45(33-43)63-72-59-49-24-14-28-64-57(49)58-50(25-15-29-65-58)60(59)73(63)48-22-8-3-9-23-48/h1-38H |
| InChIKey | COXNDIQCHBKLAW-UHFFFAOYSA-N |
| XLogP | 14.47 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.07 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|