C25H48O6 — CID 89280164
[3,5-bis(2,2-dimethylpropoxymethoxy)-4-methylcyclohexyl] 2,2-dimethylbutanoate (PubChem CID 89280164) has the molecular formula C25H48O6 and a molecular weight of 444.65 g/mol. Its IUPAC name is [3,5-bis(2,2-dimethylpropoxymethoxy)-4-methylcyclohexyl] 2,2-dimethylbutanoate.
| Compound Name | [3,5-bis(2,2-dimethylpropoxymethoxy)-4-methylcyclohexyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89280164 |
| Molecular Formula | C25H48O6 |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | [3,5-bis(2,2-dimethylpropoxymethoxy)-4-methylcyclohexyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(OCOCC(C)(C)C)C(C)C(OCOCC(C)(C)C)C1 |
| InChI | InChI=1S/C25H48O6/c1-11-25(9,10)22(26)31-19-12-20(29-16-27-14-23(3,4)5)18(2)21(13-19)30-17-28-15-24(6,7)8/h18-21H,11-17H2,1-10H3 |
| InChIKey | RDSPETPNGANOKF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|