C22H42O3Si — CID 89280222
(4S,7R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9-pentamethylundec-10-ene-2,6-dione (PubChem CID 89280222) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is (4S,7R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9-pentamethylundec-10-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9-pentamethylundec-10-ene-2,6-dione |
|---|---|
| PubChem CID | 89280222 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (4S,7R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-4,5,5,7,9-pentamethylundec-10-ene-2,6-dione |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](C)CC(C)=O |
| InChI | InChI=1S/C22H42O3Si/c1-13-15(2)19(25-26(11,12)21(6,7)8)18(5)20(24)22(9,10)16(3)14-17(4)23/h13,15-16,18-19H,1,14H2,2-12H3/t15-,16-,18+,19-/m0/s1 |
| InChIKey | FPHLSWYPWTXYGI-DKKFBQAASA-N |
| XLogP | 6.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|