C21H42O4Si — CID 89280224
(4S,7R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-4,5,5,7,9-pentamethyldecane-2,6-dione (PubChem CID 89280224) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is (4S,7R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-4,5,5,7,9-pentamethyldecane-2,6-dione.
| Compound Name | (4S,7R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-4,5,5,7,9-pentamethyldecane-2,6-dione |
|---|---|
| PubChem CID | 89280224 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (4S,7R,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-4,5,5,7,9-pentamethyldecane-2,6-dione |
| SMILES | CC(=O)C[C@H](C)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C21H42O4Si/c1-14(13-22)18(25-26(10,11)20(5,6)7)17(4)19(24)21(8,9)15(2)12-16(3)23/h14-15,17-18,22H,12-13H2,1-11H3/t14-,15-,17+,18-/m0/s1 |
| InChIKey | ZEZKMPNLRFZPHX-ONIAQPFYSA-N |
| XLogP | 4.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|