About 1-tritioindole
1-tritioindole (PubChem CID 89280765) has the molecular formula C8H7N
and a molecular weight of 119.16 g/mol. Its IUPAC name is 1-tritioindole.
Molecular Properties
| Compound Name | 1-tritioindole |
| PubChem CID | 89280765 |
| Molecular Formula | C8H7N |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 1-tritioindole |
| SMILES | [3H]n1ccc2ccccc21 |
| InChI | InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H/i/hT |
| InChIKey | SIKJAQJRHWYJAI-MNYXATJNSA-N |
| XLogP | 2.17 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tritioindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tritioindole?
The IUPAC name of 1-tritioindole (CID 89280765) is 1-tritioindole.
What is the SMILES notation for 1-tritioindole?
The canonical SMILES for 1-tritioindole is [3H]n1ccc2ccccc21.
What is the InChIKey of 1-tritioindole?
The InChIKey is SIKJAQJRHWYJAI-MNYXATJNSA-N. The full InChI is InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H/i/hT.
What are the key properties of 1-tritioindole?
1-tritioindole has a molecular weight of 119.16 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tritioindole is sourced from PubChem (CID 89280765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).