About 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid
3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid (PubChem CID 89280970) has the molecular formula C14H17NO2S
and a molecular weight of 263.36 g/mol. Its IUPAC name is 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid |
| PubChem CID | 89280970 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid |
| SMILES | C[C@@H]1C[C@H]1/C=C\c1cc(C(=O)O)cc(N(C)S)c1 |
| InChI | InChI=1S/C14H17NO2S/c1-9-5-11(9)4-3-10-6-12(14(16)17)8-13(7-10)15(2)18/h3-4,6-9,11,18H,5H2,1-2H3,(H,16,17)/b4-3-/t9-,11-/m1/s1 |
| InChIKey | GCIWTNBXSRCLHN-QKXNICGJSA-N |
| XLogP | 3.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid?
The IUPAC name of 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid (CID 89280970) is 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid.
What is the SMILES notation for 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid?
The canonical SMILES for 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid is C[C@@H]1C[C@H]1/C=C\c1cc(C(=O)O)cc(N(C)S)c1.
What is the InChIKey of 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid?
The InChIKey is GCIWTNBXSRCLHN-QKXNICGJSA-N. The full InChI is InChI=1S/C14H17NO2S/c1-9-5-11(9)4-3-10-6-12(14(16)17)8-13(7-10)15(2)18/h3-4,6-9,11,18H,5H2,1-2H3,(H,16,17)/b4-3-/t9-,11-/m1/s1.
What are the key properties of 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid?
3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid has a molecular weight of 263.36 g/mol, XLogP of 3.34, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl]-5-[methyl(sulfanyl)amino]benzoic acid is sourced from PubChem (CID 89280970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).