C12H16F8O8S2 — CID 89281069
1,1,2,2-tetrafluoro-2-[[4-[(1,1,2,2-tetrafluoro-2-sulfoethoxy)methyl]cyclohexyl]methoxy]ethanesulfonic acid (PubChem CID 89281069) has the molecular formula C12H16F8O8S2 and a molecular weight of 504.37 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[[4-[(1,1,2,2-tetrafluoro-2-sulfoethoxy)methyl]cyclohexyl]methoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[[4-[(1,1,2,2-tetrafluoro-2-sulfoethoxy)methyl]cyclohexyl]methoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 89281069 |
| Molecular Formula | C12H16F8O8S2 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[[4-[(1,1,2,2-tetrafluoro-2-sulfoethoxy)methyl]cyclohexyl]methoxy]ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OCC1CCC(COC(F)(F)C(F)(F)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C12H16F8O8S2/c13-9(14,11(17,18)29(21,22)23)27-5-7-1-2-8(4-3-7)6-28-10(15,16)12(19,20)30(24,25)26/h7-8H,1-6H2,(H,21,22,23)(H,24,25,26) |
| InChIKey | DYLDRWRLMZPFPO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|