C20H26F16O8S2 — CID 89281071
2-[5,8-diethyl-1,1,2,2,11,11,12,12-octafluoro-12-(1,1,2,2-tetrafluoro-2-sulfoethoxy)dodecoxy]-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 89281071) has the molecular formula C20H26F16O8S2 and a molecular weight of 762.52 g/mol. Its IUPAC name is 2-[5,8-diethyl-1,1,2,2,11,11,12,12-octafluoro-12-(1,1,2,2-tetrafluoro-2-sulfoethoxy)dodecoxy]-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[5,8-diethyl-1,1,2,2,11,11,12,12-octafluoro-12-(1,1,2,2-tetrafluoro-2-sulfoethoxy)dodecoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 89281071 |
| Molecular Formula | C20H26F16O8S2 |
| Molecular Weight | 762.52 g/mol |
| Exact Mass | 762.08 |
| IUPAC Name | 2-[5,8-diethyl-1,1,2,2,11,11,12,12-octafluoro-12-(1,1,2,2-tetrafluoro-2-sulfoethoxy)dodecoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CCC(CCC(CC)CCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)CCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C20H26F16O8S2/c1-3-11(7-9-13(21,22)15(25,26)43-17(29,30)19(33,34)45(37,38)39)5-6-12(4-2)8-10-14(23,24)16(27,28)44-18(31,32)20(35,36)46(40,41)42/h11-12H,3-10H2,1-2H3,(H,37,38,39)(H,40,41,42) |
| InChIKey | FIALLGSKYFSZPV-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.52 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|