C6H6F4O10S2 — CID 89281089
2-[2-(2,2-difluoro-2-sulfoacetyl)oxyethoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 89281089) has the molecular formula C6H6F4O10S2 and a molecular weight of 378.23 g/mol. Its IUPAC name is 2-[2-(2,2-difluoro-2-sulfoacetyl)oxyethoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[2-(2,2-difluoro-2-sulfoacetyl)oxyethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89281089 |
| Molecular Formula | C6H6F4O10S2 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 2-[2-(2,2-difluoro-2-sulfoacetyl)oxyethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OCCOC(=O)C(F)(F)S(=O)(=O)O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C6H6F4O10S2/c7-5(8,21(13,14)15)3(11)19-1-2-20-4(12)6(9,10)22(16,17)18/h1-2H2,(H,13,14,15)(H,16,17,18) |
| InChIKey | RWTALCDNRQHJLK-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|