C13H22S — CID 89281144
(1E,3Z,5Z)-4-butan-2-yl-1-ethylsulfanylhepta-1,3,5-triene (PubChem CID 89281144) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is (1E,3Z,5Z)-4-butan-2-yl-1-ethylsulfanylhepta-1,3,5-triene.
| Compound Name | (1E,3Z,5Z)-4-butan-2-yl-1-ethylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89281144 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (1E,3Z,5Z)-4-butan-2-yl-1-ethylsulfanylhepta-1,3,5-triene |
| SMILES | C/C=C\C(=C/C=C/SCC)C(C)CC |
| InChI | InChI=1S/C13H22S/c1-5-9-13(12(4)6-2)10-8-11-14-7-3/h5,8-12H,6-7H2,1-4H3/b9-5-,11-8+,13-10+ |
| InChIKey | HWNVHUQIYDFBRH-CRCMZLTFSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|