C10H20F3NO2S — CID 89281446
N,N-dibutyl-2,2,2-trifluoroethanesulfonamide (PubChem CID 89281446) has the molecular formula C10H20F3NO2S and a molecular weight of 275.34 g/mol. Its IUPAC name is N,N-dibutyl-2,2,2-trifluoroethanesulfonamide.
| Compound Name | N,N-dibutyl-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 89281446 |
| Molecular Formula | C10H20F3NO2S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N,N-dibutyl-2,2,2-trifluoroethanesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2S/c1-3-5-7-14(8-6-4-2)17(15,16)9-10(11,12)13/h3-9H2,1-2H3 |
| InChIKey | FVJYAKXRNHEULP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |