About 3-methylbutyl N-butyl-N-ethylcarbamate
3-methylbutyl N-butyl-N-ethylcarbamate (PubChem CID 89281450) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-methylbutyl N-butyl-N-ethylcarbamate.
Molecular Properties
| Compound Name | 3-methylbutyl N-butyl-N-ethylcarbamate |
| PubChem CID | 89281450 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 3-methylbutyl N-butyl-N-ethylcarbamate |
| SMILES | CCCCN(CC)C(=O)OCCC(C)C |
| InChI | InChI=1S/C12H25NO2/c1-5-7-9-13(6-2)12(14)15-10-8-11(3)4/h11H,5-10H2,1-4H3 |
| InChIKey | LOIAXYIHDYWWKS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutyl N-butyl-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl N-butyl-N-ethylcarbamate?
The IUPAC name of 3-methylbutyl N-butyl-N-ethylcarbamate (CID 89281450) is 3-methylbutyl N-butyl-N-ethylcarbamate.
What is the SMILES notation for 3-methylbutyl N-butyl-N-ethylcarbamate?
The canonical SMILES for 3-methylbutyl N-butyl-N-ethylcarbamate is CCCCN(CC)C(=O)OCCC(C)C.
What is the InChIKey of 3-methylbutyl N-butyl-N-ethylcarbamate?
The InChIKey is LOIAXYIHDYWWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-5-7-9-13(6-2)12(14)15-10-8-11(3)4/h11H,5-10H2,1-4H3.
What are the key properties of 3-methylbutyl N-butyl-N-ethylcarbamate?
3-methylbutyl N-butyl-N-ethylcarbamate has a molecular weight of 215.34 g/mol, XLogP of 3.29, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl N-butyl-N-ethylcarbamate is sourced from PubChem (CID 89281450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).