C11H20F5NO2S — CID 89281454
N,N-dibutyl-2,2,3,3,3-pentafluoropropane-1-sulfonamide (PubChem CID 89281454) has the molecular formula C11H20F5NO2S and a molecular weight of 325.34 g/mol. Its IUPAC name is N,N-dibutyl-2,2,3,3,3-pentafluoropropane-1-sulfonamide.
| Compound Name | N,N-dibutyl-2,2,3,3,3-pentafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 89281454 |
| Molecular Formula | C11H20F5NO2S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N,N-dibutyl-2,2,3,3,3-pentafluoropropane-1-sulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H20F5NO2S/c1-3-5-7-17(8-6-4-2)20(18,19)9-10(12,13)11(14,15)16/h3-9H2,1-2H3 |
| InChIKey | SBQMGYMCTFMKDG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|