About 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol
2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol (PubChem CID 89281499) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol.
Molecular Properties
| Compound Name | 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol |
| PubChem CID | 89281499 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol |
| SMILES | CC1OC(O)C(O)=CC1O |
| InChI | InChI=1S/C6H10O4/c1-3-4(7)2-5(8)6(9)10-3/h2-4,6-9H,1H3 |
| InChIKey | BEJCWBCCNNPCGD-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol?
The IUPAC name of 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol (CID 89281499) is 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol.
What is the SMILES notation for 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol?
The canonical SMILES for 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol is CC1OC(O)C(O)=CC1O.
What is the InChIKey of 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol?
The InChIKey is BEJCWBCCNNPCGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-3-4(7)2-5(8)6(9)10-3/h2-4,6-9H,1H3.
What are the key properties of 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol?
2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol has a molecular weight of 146.14 g/mol, XLogP of -0.47, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,6-dihydro-2H-pyran-3,5,6-triol is sourced from PubChem (CID 89281499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).