About 2,5-dioxohexyl pent-4-enoate
2,5-dioxohexyl pent-4-enoate (PubChem CID 89281649) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is 2,5-dioxohexyl pent-4-enoate.
Molecular Properties
| Compound Name | 2,5-dioxohexyl pent-4-enoate |
| PubChem CID | 89281649 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2,5-dioxohexyl pent-4-enoate |
| SMILES | C=CCCC(=O)OCC(=O)CCC(C)=O |
| InChI | InChI=1S/C11H16O4/c1-3-4-5-11(14)15-8-10(13)7-6-9(2)12/h3H,1,4-8H2,2H3 |
| InChIKey | PFFZEUAXRCQFLP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dioxohexyl pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dioxohexyl pent-4-enoate?
The IUPAC name of 2,5-dioxohexyl pent-4-enoate (CID 89281649) is 2,5-dioxohexyl pent-4-enoate.
What is the SMILES notation for 2,5-dioxohexyl pent-4-enoate?
The canonical SMILES for 2,5-dioxohexyl pent-4-enoate is C=CCCC(=O)OCC(=O)CCC(C)=O.
What is the InChIKey of 2,5-dioxohexyl pent-4-enoate?
The InChIKey is PFFZEUAXRCQFLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-3-4-5-11(14)15-8-10(13)7-6-9(2)12/h3H,1,4-8H2,2H3.
What are the key properties of 2,5-dioxohexyl pent-4-enoate?
2,5-dioxohexyl pent-4-enoate has a molecular weight of 212.24 g/mol, XLogP of 1.43, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dioxohexyl pent-4-enoate is sourced from PubChem (CID 89281649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).