About (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol
(3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol (PubChem CID 89281788) has the molecular formula C11H16F6O
and a molecular weight of 278.24 g/mol. Its IUPAC name is (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol.
Molecular Properties
| Compound Name | (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol |
| PubChem CID | 89281788 |
| Molecular Formula | C11H16F6O |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol |
| SMILES | C[C@@H](C1CCCCC1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H16F6O/c1-7(8-5-3-2-4-6-8)9(18,10(12,13)14)11(15,16)17/h7-8,18H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | UGGJFHLELTZOSX-ZETCQYMHSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol?
The IUPAC name of (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol (CID 89281788) is (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol.
What is the SMILES notation for (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol?
The canonical SMILES for (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol is C[C@@H](C1CCCCC1)C(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol?
The InChIKey is UGGJFHLELTZOSX-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H16F6O/c1-7(8-5-3-2-4-6-8)9(18,10(12,13)14)11(15,16)17/h7-8,18H,2-6H2,1H3/t7-/m0/s1.
What are the key properties of (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol?
(3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol has a molecular weight of 278.24 g/mol, XLogP of 4.06, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-cyclohexyl-1,1,1-trifluoro-2-(trifluoromethyl)butan-2-ol is sourced from PubChem (CID 89281788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).