C18H32N4O7 — CID 89281949
2-[4,8-bis(carboxymethyl)-11-(2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid (PubChem CID 89281949) has the molecular formula C18H32N4O7 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[4,8-bis(carboxymethyl)-11-(2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid.
| Compound Name | 2-[4,8-bis(carboxymethyl)-11-(2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid |
|---|---|
| PubChem CID | 89281949 |
| Molecular Formula | C18H32N4O7 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-[4,8-bis(carboxymethyl)-11-(2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid |
| SMILES | O=CCN1CCCN(CC(=O)O)CCN(CC(=O)O)CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H32N4O7/c23-12-11-19-3-1-4-21(14-17(26)27)9-10-22(15-18(28)29)6-2-5-20(8-7-19)13-16(24)25/h12H,1-11,13-15H2,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | XQTKVDQOSJWPGW-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|