C19H15Cl2NO2 — CID 8928200
2-(3,4-dichlorophenyl)-N-[(R)-furan-2-yl(phenyl)methyl]acetamide (PubChem CID 8928200) has the molecular formula C19H15Cl2NO2 and a molecular weight of 360.24 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(R)-furan-2-yl(phenyl)methyl]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(R)-furan-2-yl(phenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8928200 |
| Molecular Formula | C19H15Cl2NO2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(R)-furan-2-yl(phenyl)methyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N[C@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C19H15Cl2NO2/c20-15-9-8-13(11-16(15)21)12-18(23)22-19(17-7-4-10-24-17)14-5-2-1-3-6-14/h1-11,19H,12H2,(H,22,23)/t19-/m1/s1 |
| InChIKey | ISJJJNMXMYPTDA-LJQANCHMSA-N |
| XLogP | 5.03 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |