About (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid
(E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid (PubChem CID 89282137) has the molecular formula C17H34O2S
and a molecular weight of 302.52 g/mol. Its IUPAC name is (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid.
Molecular Properties
| Compound Name | (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid |
| PubChem CID | 89282137 |
| Molecular Formula | C17H34O2S |
| Molecular Weight | 302.52 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid |
| SMILES | CCCCCCC/C(C)=C(\C)CCCCCCS(=O)O |
| InChI | InChI=1S/C17H34O2S/c1-4-5-6-7-10-13-16(2)17(3)14-11-8-9-12-15-20(18)19/h4-15H2,1-3H3,(H,18,19)/b17-16+ |
| InChIKey | MTJJPCXBVOCGSL-WUKNDPDISA-N |
| XLogP | 5.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid?
The IUPAC name of (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid (CID 89282137) is (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid.
What is the SMILES notation for (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid?
The canonical SMILES for (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid is CCCCCCC/C(C)=C(\C)CCCCCCS(=O)O.
What is the InChIKey of (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid?
The InChIKey is MTJJPCXBVOCGSL-WUKNDPDISA-N. The full InChI is InChI=1S/C17H34O2S/c1-4-5-6-7-10-13-16(2)17(3)14-11-8-9-12-15-20(18)19/h4-15H2,1-3H3,(H,18,19)/b17-16+.
What are the key properties of (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid?
(E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid has a molecular weight of 302.52 g/mol, XLogP of 5.86, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7,8-dimethylpentadec-7-ene-1-sulfinic acid is sourced from PubChem (CID 89282137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).