C17H20F3N5O — CID 89282283
3-[[5-amino-2-propyl-4-(trifluoromethyl)indol-1-yl]methyl]-N,N-dimethyl-1,2,4-oxadiazol-5-amine (PubChem CID 89282283) has the molecular formula C17H20F3N5O and a molecular weight of 367.38 g/mol. Its IUPAC name is 3-[[5-amino-2-propyl-4-(trifluoromethyl)indol-1-yl]methyl]-N,N-dimethyl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-[[5-amino-2-propyl-4-(trifluoromethyl)indol-1-yl]methyl]-N,N-dimethyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 89282283 |
| Molecular Formula | C17H20F3N5O |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-[[5-amino-2-propyl-4-(trifluoromethyl)indol-1-yl]methyl]-N,N-dimethyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCCc1cc2c(C(F)(F)F)c(N)ccc2n1Cc1noc(N(C)C)n1 |
| InChI | InChI=1S/C17H20F3N5O/c1-4-5-10-8-11-13(7-6-12(21)15(11)17(18,19)20)25(10)9-14-22-16(24(2)3)26-23-14/h6-8H,4-5,9,21H2,1-3H3 |
| InChIKey | NCLLYTOKVCDGBZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|