About [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol
[5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol (PubChem CID 89282565) has the molecular formula C11H11F3N2O
and a molecular weight of 244.22 g/mol. Its IUPAC name is [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol.
Molecular Properties
| Compound Name | [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol |
| PubChem CID | 89282565 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol |
| SMILES | Nc1ccc2c(c1)cc(CO)n2CC(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O/c12-11(13,14)6-16-9(5-17)4-7-3-8(15)1-2-10(7)16/h1-4,17H,5-6,15H2 |
| InChIKey | SNTKLAWVVUGVLD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol?
The IUPAC name of [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol (CID 89282565) is [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol.
What is the SMILES notation for [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol?
The canonical SMILES for [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol is Nc1ccc2c(c1)cc(CO)n2CC(F)(F)F.
What is the InChIKey of [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol?
The InChIKey is SNTKLAWVVUGVLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3N2O/c12-11(13,14)6-16-9(5-17)4-7-3-8(15)1-2-10(7)16/h1-4,17H,5-6,15H2.
What are the key properties of [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol?
[5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol has a molecular weight of 244.22 g/mol, XLogP of 2.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol is sourced from PubChem (CID 89282565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).