C18H11Cl2F3N4O — CID 89282585
1-[[5-(3,5-dichlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-4-(trifluoromethyl)indol-5-amine (PubChem CID 89282585) has the molecular formula C18H11Cl2F3N4O and a molecular weight of 427.21 g/mol. Its IUPAC name is 1-[[5-(3,5-dichlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-4-(trifluoromethyl)indol-5-amine.
| Compound Name | 1-[[5-(3,5-dichlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-4-(trifluoromethyl)indol-5-amine |
|---|---|
| PubChem CID | 89282585 |
| Molecular Formula | C18H11Cl2F3N4O |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 1-[[5-(3,5-dichlorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-4-(trifluoromethyl)indol-5-amine |
| SMILES | Nc1ccc2c(ccn2Cc2noc(-c3cc(Cl)cc(Cl)c3)n2)c1C(F)(F)F |
| InChI | InChI=1S/C18H11Cl2F3N4O/c19-10-5-9(6-11(20)7-10)17-25-15(26-28-17)8-27-4-3-12-14(27)2-1-13(24)16(12)18(21,22)23/h1-7H,8,24H2 |
| InChIKey | YMIRMWHRQCCOMZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|