About 4-methyl-1,3-thiazolidine-3-carbaldehyde
4-methyl-1,3-thiazolidine-3-carbaldehyde (PubChem CID 89282689) has the molecular formula C5H9NOS
and a molecular weight of 131.20 g/mol. Its IUPAC name is 4-methyl-1,3-thiazolidine-3-carbaldehyde.
Molecular Properties
| Compound Name | 4-methyl-1,3-thiazolidine-3-carbaldehyde |
| PubChem CID | 89282689 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 4-methyl-1,3-thiazolidine-3-carbaldehyde |
| SMILES | CC1CSCN1C=O |
| InChI | InChI=1S/C5H9NOS/c1-5-2-8-4-6(5)3-7/h3,5H,2,4H2,1H3 |
| InChIKey | BQYFFACSFHEGDU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,3-thiazolidine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-thiazolidine-3-carbaldehyde?
The IUPAC name of 4-methyl-1,3-thiazolidine-3-carbaldehyde (CID 89282689) is 4-methyl-1,3-thiazolidine-3-carbaldehyde.
What is the SMILES notation for 4-methyl-1,3-thiazolidine-3-carbaldehyde?
The canonical SMILES for 4-methyl-1,3-thiazolidine-3-carbaldehyde is CC1CSCN1C=O.
What is the InChIKey of 4-methyl-1,3-thiazolidine-3-carbaldehyde?
The InChIKey is BQYFFACSFHEGDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NOS/c1-5-2-8-4-6(5)3-7/h3,5H,2,4H2,1H3.
What are the key properties of 4-methyl-1,3-thiazolidine-3-carbaldehyde?
4-methyl-1,3-thiazolidine-3-carbaldehyde has a molecular weight of 131.20 g/mol, XLogP of 0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-thiazolidine-3-carbaldehyde is sourced from PubChem (CID 89282689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).