C11H17I — CID 89282690
(6S)-6-iodo-8-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene (PubChem CID 89282690) has the molecular formula C11H17I and a molecular weight of 276.16 g/mol. Its IUPAC name is (6S)-6-iodo-8-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene.
| Compound Name | (6S)-6-iodo-8-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 89282690 |
| Molecular Formula | C11H17I |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (6S)-6-iodo-8-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| SMILES | CC1=C[C@@H](I)CC2CCCCC12 |
| InChI | InChI=1S/C11H17I/c1-8-6-10(12)7-9-4-2-3-5-11(8)9/h6,9-11H,2-5,7H2,1H3/t9?,10-,11?/m1/s1 |
| InChIKey | DCOWKRXRSMLXOS-HSOILSAZSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|