C18H21NO2 — CID 89283384
6-[(E)-3,6,6-trimethyl-5-methylideneoct-3-en-1-ynyl]pyridine-3-carboxylic acid (PubChem CID 89283384) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 6-[(E)-3,6,6-trimethyl-5-methylideneoct-3-en-1-ynyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[(E)-3,6,6-trimethyl-5-methylideneoct-3-en-1-ynyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 89283384 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 6-[(E)-3,6,6-trimethyl-5-methylideneoct-3-en-1-ynyl]pyridine-3-carboxylic acid |
| SMILES | C=C(/C=C(\C)C#Cc1ccc(C(=O)O)cn1)C(C)(C)CC |
| InChI | InChI=1S/C18H21NO2/c1-6-18(4,5)14(3)11-13(2)7-9-16-10-8-15(12-19-16)17(20)21/h8,10-12H,3,6H2,1-2,4-5H3,(H,20,21)/b13-11+ |
| InChIKey | JELRERKMCRNTBM-ACCUITESSA-N |
| XLogP | 4.07 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|