About [cyano(methyl)amino] methyl carbonate
[cyano(methyl)amino] methyl carbonate (PubChem CID 89283667) has the molecular formula C4H6N2O3
and a molecular weight of 130.10 g/mol. Its IUPAC name is [cyano(methyl)amino] methyl carbonate.
Molecular Properties
| Compound Name | [cyano(methyl)amino] methyl carbonate |
| PubChem CID | 89283667 |
| Molecular Formula | C4H6N2O3 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | [cyano(methyl)amino] methyl carbonate |
| SMILES | COC(=O)ON(C)C#N |
| InChI | InChI=1S/C4H6N2O3/c1-6(3-5)9-4(7)8-2/h1-2H3 |
| InChIKey | SROHZZIBSASLIQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [cyano(methyl)amino] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyano(methyl)amino] methyl carbonate?
The IUPAC name of [cyano(methyl)amino] methyl carbonate (CID 89283667) is [cyano(methyl)amino] methyl carbonate.
What is the SMILES notation for [cyano(methyl)amino] methyl carbonate?
The canonical SMILES for [cyano(methyl)amino] methyl carbonate is COC(=O)ON(C)C#N.
What is the InChIKey of [cyano(methyl)amino] methyl carbonate?
The InChIKey is SROHZZIBSASLIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O3/c1-6(3-5)9-4(7)8-2/h1-2H3.
What are the key properties of [cyano(methyl)amino] methyl carbonate?
[cyano(methyl)amino] methyl carbonate has a molecular weight of 130.10 g/mol, XLogP of 0.10, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [cyano(methyl)amino] methyl carbonate is sourced from PubChem (CID 89283667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).