C25H28BrNO4S — CID 89283703
(4aR,9S,10R)-9-(2-bromophenyl)sulfanyl-5,6-dihydroxy-2-methoxy-10-methyl-4a-[2-(methylamino)ethyl]-4,9,10,10a-tetrahydrophenanthren-3-one (PubChem CID 89283703) has the molecular formula C25H28BrNO4S and a molecular weight of 518.47 g/mol. Its IUPAC name is (4aR,9S,10R)-9-(2-bromophenyl)sulfanyl-5,6-dihydroxy-2-methoxy-10-methyl-4a-[2-(methylamino)ethyl]-4,9,10,10a-tetrahydrophenanthren-3-one.
| Compound Name | (4aR,9S,10R)-9-(2-bromophenyl)sulfanyl-5,6-dihydroxy-2-methoxy-10-methyl-4a-[2-(methylamino)ethyl]-4,9,10,10a-tetrahydrophenanthren-3-one |
|---|---|
| PubChem CID | 89283703 |
| Molecular Formula | C25H28BrNO4S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | (4aR,9S,10R)-9-(2-bromophenyl)sulfanyl-5,6-dihydroxy-2-methoxy-10-methyl-4a-[2-(methylamino)ethyl]-4,9,10,10a-tetrahydrophenanthren-3-one |
| SMILES | CNCC[C@@]12CC(=O)C(OC)=CC1[C@@H](C)[C@H](Sc1ccccc1Br)c1ccc(O)c(O)c12 |
| InChI | InChI=1S/C25H28BrNO4S/c1-14-16-12-20(31-3)19(29)13-25(16,10-11-27-2)22-15(8-9-18(28)23(22)30)24(14)32-21-7-5-4-6-17(21)26/h4-9,12,14,16,24,27-28,30H,10-11,13H2,1-3H3/t14-,16?,24+,25-/m1/s1 |
| InChIKey | BIGQHONPXPSDEJ-YJTBVQMCSA-N |
| XLogP | 5.31 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|