C21H19F5N4O2 — CID 89283847
2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methyl]aniline (PubChem CID 89283847) has the molecular formula C21H19F5N4O2 and a molecular weight of 454.40 g/mol. Its IUPAC name is 2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methyl]aniline.
| Compound Name | 2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 89283847 |
| Molecular Formula | C21H19F5N4O2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methyl]aniline |
| SMILES | Cn1cc(C(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2NCc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C21H19F5N4O2/c1-21(2,3)13-9-29(4)28-20(13)11-7-10(30(31)32)5-6-14(11)27-8-12-15(22)17(24)19(26)18(25)16(12)23/h5-7,9,27H,8H2,1-4H3 |
| InChIKey | PMMAZXNIPUDKRG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|