C21H20F4N4O2 — CID 89283888
2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitro-N-[(2,3,5,6-tetrafluorophenyl)methyl]aniline (PubChem CID 89283888) has the molecular formula C21H20F4N4O2 and a molecular weight of 436.40 g/mol. Its IUPAC name is 2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitro-N-[(2,3,5,6-tetrafluorophenyl)methyl]aniline.
| Compound Name | 2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitro-N-[(2,3,5,6-tetrafluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 89283888 |
| Molecular Formula | C21H20F4N4O2 |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-(4-tert-butyl-1-methylpyrazol-3-yl)-4-nitro-N-[(2,3,5,6-tetrafluorophenyl)methyl]aniline |
| SMILES | CC(C)(C)C1=CN(N=C1C2=C(C=CC(=C2)[N+](=O)[O-])NCC3=C(C(=CC(=C3F)F)F)F)C |
| InChI | InChI=1S/C21H20F4N4O2/c1-21(2,3)14-10-28(4)27-20(14)12-7-11(29(30)31)5-6-17(12)26-9-13-18(24)15(22)8-16(23)19(13)25/h5-8,10,26H,9H2,1-4H3 |
| InChIKey | VWTBVEPSTPKIAR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | 617 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|