About 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide
2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide (PubChem CID 89283954) has the molecular formula C12H11F8NO2S
and a molecular weight of 385.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide |
| PubChem CID | 89283954 |
| Molecular Formula | C12H11F8NO2S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide |
| SMILES | CCC(=O)c1cc(N(C)C(=O)C(F)(F)F)cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F8NO2S/c1-3-10(22)7-4-8(21(2)11(23)12(13,14)15)6-9(5-7)24(16,17,18,19)20/h4-6H,3H2,1-2H3 |
| InChIKey | FCPPQVMENGYJHX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide?
The IUPAC name of 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide (CID 89283954) is 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide.
What is the SMILES notation for 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide?
The canonical SMILES for 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide is CCC(=O)c1cc(N(C)C(=O)C(F)(F)F)cc(S(F)(F)(F)(F)F)c1.
What is the InChIKey of 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide?
The InChIKey is FCPPQVMENGYJHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F8NO2S/c1-3-10(22)7-4-8(21(2)11(23)12(13,14)15)6-9(5-7)24(16,17,18,19)20/h4-6H,3H2,1-2H3.
What are the key properties of 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide?
2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide has a molecular weight of 385.28 g/mol, XLogP of 5.46, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N-methyl-N-[3-(pentafluoro-λ6-sulfanyl)-5-propanoylphenyl]acetamide is sourced from PubChem (CID 89283954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).