About 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene
1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene (PubChem CID 89284117) has the molecular formula C14H20S
and a molecular weight of 220.38 g/mol. Its IUPAC name is 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene |
| PubChem CID | 89284117 |
| Molecular Formula | C14H20S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene |
| SMILES | CC/C(=C\C=C(C)C)SC1=CC=CCC1 |
| InChI | InChI=1S/C14H20S/c1-4-13(11-10-12(2)3)15-14-8-6-5-7-9-14/h5-6,8,10-11H,4,7,9H2,1-3H3/b13-11+ |
| InChIKey | ITANWAFHYKLAMC-ACCUITESSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene?
The IUPAC name of 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene (CID 89284117) is 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene.
What is the SMILES notation for 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene?
The canonical SMILES for 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene is CC/C(=C\C=C(C)C)SC1=CC=CCC1.
What is the InChIKey of 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene?
The InChIKey is ITANWAFHYKLAMC-ACCUITESSA-N. The full InChI is InChI=1S/C14H20S/c1-4-13(11-10-12(2)3)15-14-8-6-5-7-9-14/h5-6,8,10-11H,4,7,9H2,1-3H3/b13-11+.
What are the key properties of 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene?
1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene has a molecular weight of 220.38 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-6-methylhepta-3,5-dien-3-yl]sulfanylcyclohexa-1,3-diene is sourced from PubChem (CID 89284117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).