C19H31O2P — CID 89284124
diethoxy-[(4E,6E)-3,7,11-trimethyldodeca-1,2,4,6,10-pentaenyl]phosphane (PubChem CID 89284124) has the molecular formula C19H31O2P and a molecular weight of 322.43 g/mol. Its IUPAC name is diethoxy-[(4E,6E)-3,7,11-trimethyldodeca-1,2,4,6,10-pentaenyl]phosphane.
| Compound Name | diethoxy-[(4E,6E)-3,7,11-trimethyldodeca-1,2,4,6,10-pentaenyl]phosphane |
|---|---|
| PubChem CID | 89284124 |
| Molecular Formula | C19H31O2P |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | diethoxy-[(4E,6E)-3,7,11-trimethyldodeca-1,2,4,6,10-pentaenyl]phosphane |
| SMILES | CCOP(C=C=C(C)/C=C/C=C(\C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C19H31O2P/c1-7-20-22(21-8-2)16-15-19(6)14-10-13-18(5)12-9-11-17(3)4/h10-11,13-14,16H,7-9,12H2,1-6H3/b14-10+,18-13+ |
| InChIKey | LEQCKRVZDAIYSQ-RQGHQXAZSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|