C27H48N4O — CID 89284150
(3E)-2-methylidene-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexa-3,5-dienamide (PubChem CID 89284150) has the molecular formula C27H48N4O and a molecular weight of 444.71 g/mol. Its IUPAC name is (3E)-2-methylidene-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexa-3,5-dienamide.
| Compound Name | (3E)-2-methylidene-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexa-3,5-dienamide |
|---|---|
| PubChem CID | 89284150 |
| Molecular Formula | C27H48N4O |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | (3E)-2-methylidene-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexa-3,5-dienamide |
| SMILES | C=C(/C=C/C(=C)C(=O)NC1CC(C)(C)N(C)C(C)(C)C1)NC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C27H48N4O/c1-19(23(32)29-22-17-26(7,8)31(12)27(9,10)18-22)13-14-20(2)28-21-15-24(3,4)30(11)25(5,6)16-21/h13-14,21-22,28H,1-2,15-18H2,3-12H3,(H,29,32)/b14-13+ |
| InChIKey | UEVHCFZDTAYXMG-BUHFOSPRSA-N |
| XLogP | 4.62 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|