About 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one
2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one (PubChem CID 89284176) has the molecular formula C15H14O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one.
Molecular Properties
| Compound Name | 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one |
| PubChem CID | 89284176 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one |
| SMILES | C=C1C(=O)C2=C(OC(CC)C2)c2ccccc21 |
| InChI | InChI=1S/C15H14O2/c1-3-10-8-13-14(16)9(2)11-6-4-5-7-12(11)15(13)17-10/h4-7,10H,2-3,8H2,1H3 |
| InChIKey | BZTOAKNGXQWTQV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one?
The IUPAC name of 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one (CID 89284176) is 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one.
What is the SMILES notation for 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one?
The canonical SMILES for 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one is C=C1C(=O)C2=C(OC(CC)C2)c2ccccc21.
What is the InChIKey of 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one?
The InChIKey is BZTOAKNGXQWTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2/c1-3-10-8-13-14(16)9(2)11-6-4-5-7-12(11)15(13)17-10/h4-7,10H,2-3,8H2,1H3.
What are the key properties of 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one?
2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one has a molecular weight of 226.28 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methylidene-2,3-dihydrobenzo[g][1]benzofuran-4-one is sourced from PubChem (CID 89284176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).